C15H19Cl2NO2 — CID 106229990
1-(2,5-dichlorophenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol (PubChem CID 106229990) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 1-(2,5-dichlorophenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol.
| Compound Name | 1-(2,5-dichlorophenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 106229990 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 1-(2,5-dichlorophenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol |
| SMILES | C#CC(CCC)NCC(O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H19Cl2NO2/c1-3-5-12(4-2)18-9-13(19)10-20-15-8-11(16)6-7-14(15)17/h2,6-8,12-13,18-19H,3,5,9-10H2,1H3 |
| InChIKey | FDNMJXZHYOFQEX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|