C17H25NO2 — CID 106229993
1-(2,4-dimethylphenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol (PubChem CID 106229993) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-(2,4-dimethylphenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol.
| Compound Name | 1-(2,4-dimethylphenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 106229993 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-(2,4-dimethylphenoxy)-3-(hex-1-yn-3-ylamino)propan-2-ol |
| SMILES | C#CC(CCC)NCC(O)COc1ccc(C)cc1C |
| InChI | InChI=1S/C17H25NO2/c1-5-7-15(6-2)18-11-16(19)12-20-17-9-8-13(3)10-14(17)4/h2,8-10,15-16,18-19H,5,7,11-12H2,1,3-4H3 |
| InChIKey | OKYWNAKSRNGLRN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|