C9H12Cl2NO2+ — CID 9159109
[(2S)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]azanium (PubChem CID 9159109) has the molecular formula C9H12Cl2NO2+ and a molecular weight of 237.11 g/mol. Its IUPAC name is [(2S)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]azanium.
| Compound Name | [(2S)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 9159109 |
| Molecular Formula | C9H12Cl2NO2+ |
| Molecular Weight | 237.11 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | [(2S)-3-(2,5-dichlorophenoxy)-2-hydroxypropyl]azanium |
| SMILES | [NH3+]C[C@H](O)COc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H11Cl2NO2/c10-6-1-2-8(11)9(3-6)14-5-7(13)4-12/h1-3,7,13H,4-5,12H2/p+1/t7-/m0/s1 |
| InChIKey | GZFSQWVTRGNOJS-ZETCQYMHSA-O |
| XLogP | 0.98 |
| TPSA | 57.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.11 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |