C10H13Cl2NO5S — CID 2832246
[3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-methylsulfamic acid (PubChem CID 2832246) has the molecular formula C10H13Cl2NO5S and a molecular weight of 330.19 g/mol. Its IUPAC name is [3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-methylsulfamic acid.
| Compound Name | [3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 2832246 |
| Molecular Formula | C10H13Cl2NO5S |
| Molecular Weight | 330.19 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | [3-(2,5-dichlorophenoxy)-2-hydroxypropyl]-methylsulfamic acid |
| SMILES | CN(CC(O)COc1cc(Cl)ccc1Cl)S(=O)(=O)O |
| InChI | InChI=1S/C10H13Cl2NO5S/c1-13(19(15,16)17)5-8(14)6-18-10-4-7(11)2-3-9(10)12/h2-4,8,14H,5-6H2,1H3,(H,15,16,17) |
| InChIKey | DWNDDVWOYWXNAJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|