C12H19NO5S — CID 2054528
[(2R)-3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylsulfamic acid (PubChem CID 2054528) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is [(2R)-3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylsulfamic acid.
| Compound Name | [(2R)-3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylsulfamic acid |
|---|---|
| PubChem CID | 2054528 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [(2R)-3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylsulfamic acid |
| SMILES | Cc1cccc(C)c1OC[C@H](O)CN(C)S(=O)(=O)O |
| InChI | InChI=1S/C12H19NO5S/c1-9-5-4-6-10(2)12(9)18-8-11(14)7-13(3)19(15,16)17/h4-6,11,14H,7-8H2,1-3H3,(H,15,16,17)/t11-/m1/s1 |
| InChIKey | PFHPZGZMRSEQLT-LLVKDONJSA-N |
| XLogP | 0.78 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|