About 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol
2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol (PubChem CID 109394110) has the molecular formula C18H29NO3
and a molecular weight of 307.43 g/mol. Its IUPAC name is 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol |
| PubChem CID | 109394110 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol |
| SMILES | Cc1cccc(C)c1OCC(O)CN(C)CC1CCCC1O |
| InChI | InChI=1S/C18H29NO3/c1-13-6-4-7-14(2)18(13)22-12-16(20)11-19(3)10-15-8-5-9-17(15)21/h4,6-7,15-17,20-21H,5,8-12H2,1-3H3 |
| InChIKey | FSROTBQVGDSTPD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol?
The IUPAC name of 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol (CID 109394110) is 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol?
The canonical SMILES for 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol is Cc1cccc(C)c1OCC(O)CN(C)CC1CCCC1O.
What is the InChIKey of 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol?
The InChIKey is FSROTBQVGDSTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO3/c1-13-6-4-7-14(2)18(13)22-12-16(20)11-19(3)10-15-8-5-9-17(15)21/h4,6-7,15-17,20-21H,5,8-12H2,1-3H3.
What are the key properties of 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol?
2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol has a molecular weight of 307.43 g/mol, XLogP of 2.14, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[3-(2,6-dimethylphenoxy)-2-hydroxypropyl]-methylamino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 109394110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).