C19H31NO3 — CID 109394116
2-[[[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-methylamino]methyl]cyclopentan-1-ol (PubChem CID 109394116) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-[[[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-methylamino]methyl]cyclopentan-1-ol.
| Compound Name | 2-[[[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-methylamino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 109394116 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 2-[[[2-hydroxy-3-(2-propan-2-ylphenoxy)propyl]-methylamino]methyl]cyclopentan-1-ol |
| SMILES | CC(C)c1ccccc1OCC(O)CN(C)CC1CCCC1O |
| InChI | InChI=1S/C19H31NO3/c1-14(2)17-8-4-5-10-19(17)23-13-16(21)12-20(3)11-15-7-6-9-18(15)22/h4-5,8,10,14-16,18,21-22H,6-7,9,11-13H2,1-3H3 |
| InChIKey | MICRWFYGDAJKOP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |