C20H33NO2 — CID 4799215
1-(cyclooctylamino)-3-(2-propan-2-ylphenoxy)propan-2-ol (PubChem CID 4799215) has the molecular formula C20H33NO2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 1-(cyclooctylamino)-3-(2-propan-2-ylphenoxy)propan-2-ol.
| Compound Name | 1-(cyclooctylamino)-3-(2-propan-2-ylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4799215 |
| Molecular Formula | C20H33NO2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.25 |
| IUPAC Name | 1-(cyclooctylamino)-3-(2-propan-2-ylphenoxy)propan-2-ol |
| SMILES | CC(C)c1ccccc1OCC(O)CNC1CCCCCCC1 |
| InChI | InChI=1S/C20H33NO2/c1-16(2)19-12-8-9-13-20(19)23-15-18(22)14-21-17-10-6-4-3-5-7-11-17/h8-9,12-13,16-18,21-22H,3-7,10-11,14-15H2,1-2H3 |
| InChIKey | FUDGEJZLFQHFBC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |