C15H22BrNO2 — CID 804670
(2R)-1-(2-bromophenoxy)-3-(cyclohexylamino)propan-2-ol (PubChem CID 804670) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is (2R)-1-(2-bromophenoxy)-3-(cyclohexylamino)propan-2-ol.
| Compound Name | (2R)-1-(2-bromophenoxy)-3-(cyclohexylamino)propan-2-ol |
|---|---|
| PubChem CID | 804670 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (2R)-1-(2-bromophenoxy)-3-(cyclohexylamino)propan-2-ol |
| SMILES | O[C@H](CNC1CCCCC1)COc1ccccc1Br |
| InChI | InChI=1S/C15H22BrNO2/c16-14-8-4-5-9-15(14)19-11-13(18)10-17-12-6-2-1-3-7-12/h4-5,8-9,12-13,17-18H,1-3,6-7,10-11H2/t13-/m1/s1 |
| InChIKey | SPWCMRXATBXDBE-CYBMUJFWSA-N |
| XLogP | 3.11 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |