C15H23BrNO2+ — CID 7420719
[(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]-cyclohexylazanium (PubChem CID 7420719) has the molecular formula C15H23BrNO2+ and a molecular weight of 329.26 g/mol. Its IUPAC name is [(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]-cyclohexylazanium.
| Compound Name | [(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]-cyclohexylazanium |
|---|---|
| PubChem CID | 7420719 |
| Molecular Formula | C15H23BrNO2+ |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | [(2R)-3-(2-bromophenoxy)-2-hydroxypropyl]-cyclohexylazanium |
| SMILES | O[C@H](C[NH2+]C1CCCCC1)COc1ccccc1Br |
| InChI | InChI=1S/C15H22BrNO2/c16-14-8-4-5-9-15(14)19-11-13(18)10-17-12-6-2-1-3-7-12/h4-5,8-9,12-13,17-18H,1-3,6-7,10-11H2/p+1/t13-/m1/s1 |
| InChIKey | SPWCMRXATBXDBE-CYBMUJFWSA-O |
| XLogP | 2.08 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |