C17H26NO2+ — CID 2142734
cyclopentyl-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]azanium (PubChem CID 2142734) has the molecular formula C17H26NO2+ and a molecular weight of 276.40 g/mol. Its IUPAC name is cyclopentyl-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]azanium.
| Compound Name | cyclopentyl-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 2142734 |
| Molecular Formula | C17H26NO2+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | cyclopentyl-[(2S)-2-hydroxy-3-(2-prop-2-enylphenoxy)propyl]azanium |
| SMILES | C=CCc1ccccc1OC[C@@H](O)C[NH2+]C1CCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-2-7-14-8-3-6-11-17(14)20-13-16(19)12-18-15-9-4-5-10-15/h2-3,6,8,11,15-16,18-19H,1,4-5,7,9-10,12-13H2/p+1/t16-/m0/s1 |
| InChIKey | DDRWZNIIZPLDMD-INIZCTEOSA-O |
| XLogP | 1.66 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|