C17H26NO2+ — CID 4619097
1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 4619097) has the molecular formula C17H26NO2+ and a molecular weight of 276.40 g/mol. Its IUPAC name is 1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | 1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 4619097 |
| Molecular Formula | C17H26NO2+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 1-piperidin-1-ium-1-yl-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OCC(O)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-2-8-15-9-4-5-10-17(15)20-14-16(19)13-18-11-6-3-7-12-18/h2,4-5,9-10,16,19H,1,3,6-8,11-14H2/p+1 |
| InChIKey | UXGVMKSFFBJMQJ-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|