C22H28FN2O2+ — CID 6981428
(2R)-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol (PubChem CID 6981428) has the molecular formula C22H28FN2O2+ and a molecular weight of 371.48 g/mol. Its IUPAC name is (2R)-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol.
| Compound Name | (2R)-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6981428 |
| Molecular Formula | C22H28FN2O2+ |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2R)-1-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol |
| SMILES | C=CCc1ccccc1OC[C@H](O)C[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H27FN2O2/c1-2-7-18-8-3-6-11-22(18)27-17-19(26)16-24-12-14-25(15-13-24)21-10-5-4-9-20(21)23/h2-6,8-11,19,26H,1,7,12-17H2/p+1/t19-/m1/s1 |
| InChIKey | VJJXLBGKOZOUEN-LJQANCHMSA-O |
| XLogP | 1.70 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|