C21H28FN2O2+ — CID 8890798
(2R)-1-(3-ethylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 8890798) has the molecular formula C21H28FN2O2+ and a molecular weight of 359.47 g/mol. Its IUPAC name is (2R)-1-(3-ethylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(3-ethylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 8890798 |
| Molecular Formula | C21H28FN2O2+ |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (2R)-1-(3-ethylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | CCc1cccc(OC[C@H](O)C[NH+]2CCN(c3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C21H27FN2O2/c1-2-17-6-5-7-19(14-17)26-16-18(25)15-23-10-12-24(13-11-23)21-9-4-3-8-20(21)22/h3-9,14,18,25H,2,10-13,15-16H2,1H3/p+1/t18-/m1/s1 |
| InChIKey | IJFOGBROIKLYAP-GOSISDBHSA-O |
| XLogP | 1.53 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |