C23H32FN2O2+ — CID 6959952
(2R)-1-(2-tert-butylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 6959952) has the molecular formula C23H32FN2O2+ and a molecular weight of 387.52 g/mol. Its IUPAC name is (2R)-1-(2-tert-butylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2R)-1-(2-tert-butylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 6959952 |
| Molecular Formula | C23H32FN2O2+ |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | (2R)-1-(2-tert-butylphenoxy)-3-[4-(2-fluorophenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | CC(C)(C)c1ccccc1OC[C@H](O)C[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C23H31FN2O2/c1-23(2,3)19-8-4-7-11-22(19)28-17-18(27)16-25-12-14-26(15-13-25)21-10-6-5-9-20(21)24/h4-11,18,27H,12-17H2,1-3H3/p+1/t18-/m1/s1 |
| InChIKey | ULOUNIZDVMGORF-GOSISDBHSA-O |
| XLogP | 2.27 |
| TPSA | 37.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |