C25H36FN2O+ — CID 7047458
2,6-ditert-butyl-4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]phenol (PubChem CID 7047458) has the molecular formula C25H36FN2O+ and a molecular weight of 399.57 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 7047458 |
| Molecular Formula | C25H36FN2O+ |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 2,6-ditert-butyl-4-[[4-(2-fluorophenyl)piperazin-1-ium-1-yl]methyl]phenol |
| SMILES | CC(C)(C)c1cc(C[NH+]2CCN(c3ccccc3F)CC2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H35FN2O/c1-24(2,3)19-15-18(16-20(23(19)29)25(4,5)6)17-27-11-13-28(14-12-27)22-10-8-7-9-21(22)26/h7-10,15-16,29H,11-14,17H2,1-6H3/p+1 |
| InChIKey | HJNPRHAFFABGEM-UHFFFAOYSA-O |
| XLogP | 4.03 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |