C20H27N2O4+ — CID 6961984
2,6-dimethoxy-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]phenol (PubChem CID 6961984) has the molecular formula C20H27N2O4+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]phenol.
| Compound Name | 2,6-dimethoxy-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 6961984 |
| Molecular Formula | C20H27N2O4+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2,6-dimethoxy-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]phenol |
| SMILES | COc1ccccc1N1CC[NH+](Cc2cc(OC)c(O)c(OC)c2)CC1 |
| InChI | InChI=1S/C20H26N2O4/c1-24-17-7-5-4-6-16(17)22-10-8-21(9-11-22)14-15-12-18(25-2)20(23)19(13-15)26-3/h4-7,12-13,23H,8-11,14H2,1-3H3/p+1 |
| InChIKey | SSGVXFFWIUCKQI-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |