C19H25N2O+ — CID 6940048
1-(2-methoxyphenyl)-4-[(3-methylphenyl)methyl]piperazin-4-ium (PubChem CID 6940048) has the molecular formula C19H25N2O+ and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[(3-methylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2-methoxyphenyl)-4-[(3-methylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 6940048 |
| Molecular Formula | C19H25N2O+ |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.20 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[(3-methylphenyl)methyl]piperazin-4-ium |
| SMILES | COc1ccccc1N1CC[NH+](Cc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C19H24N2O/c1-16-6-5-7-17(14-16)15-20-10-12-21(13-11-20)18-8-3-4-9-19(18)22-2/h3-9,14H,10-13,15H2,1-2H3/p+1 |
| InChIKey | ZGUNLOZXOZVAKX-UHFFFAOYSA-O |
| XLogP | 1.91 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |