C16H21N2OS+ — CID 6940058
1-(2-methoxyphenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium (PubChem CID 6940058) has the molecular formula C16H21N2OS+ and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium.
| Compound Name | 1-(2-methoxyphenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 6940058 |
| Molecular Formula | C16H21N2OS+ |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-(thiophen-3-ylmethyl)piperazin-4-ium |
| SMILES | COc1ccccc1N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C16H20N2OS/c1-19-16-5-3-2-4-15(16)18-9-7-17(8-10-18)12-14-6-11-20-13-14/h2-6,11,13H,7-10,12H2,1H3/p+1 |
| InChIKey | WYWZGBZCYGPUTL-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 16.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |