C20H25N2O3+ — CID 8687208
methyl 3-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoate (PubChem CID 8687208) has the molecular formula C20H25N2O3+ and a molecular weight of 341.43 g/mol. Its IUPAC name is methyl 3-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 3-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 8687208 |
| Molecular Formula | C20H25N2O3+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | methyl 3-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1cccc(C[NH+]2CCN(c3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-24-19-9-4-3-8-18(19)22-12-10-21(11-13-22)15-16-6-5-7-17(14-16)20(23)25-2/h3-9,14H,10-13,15H2,1-2H3/p+1 |
| InChIKey | KBIUXAQDANNTND-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |