C19H25N2O4+ — CID 8686947
methyl 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate (PubChem CID 8686947) has the molecular formula C19H25N2O4+ and a molecular weight of 345.42 g/mol. Its IUPAC name is methyl 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate.
| Compound Name | methyl 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8686947 |
| Molecular Formula | C19H25N2O4+ |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | methyl 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(C[NH+]2CCN(c3ccccc3OC)CC2)oc1C |
| InChI | InChI=1S/C19H24N2O4/c1-14-16(19(22)24-3)12-15(25-14)13-20-8-10-21(11-9-20)17-6-4-5-7-18(17)23-2/h4-7,12H,8-11,13H2,1-3H3/p+1 |
| InChIKey | YKOIZMYKOMDRCJ-UHFFFAOYSA-O |
| XLogP | 1.29 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |