C18H22N2O4 — CID 42234290
4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-methylfuran-2-carboxylate (PubChem CID 42234290) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-methylfuran-2-carboxylate.
| Compound Name | 4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 42234290 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]-5-methylfuran-2-carboxylate |
| SMILES | COc1ccccc1N1CC[NH+](Cc2cc(C(=O)[O-])oc2C)CC1 |
| InChI | InChI=1S/C18H22N2O4/c1-13-14(11-17(24-13)18(21)22)12-19-7-9-20(10-8-19)15-5-3-4-6-16(15)23-2/h3-6,11H,7-10,12H2,1-2H3,(H,21,22) |
| InChIKey | XEBVXHDEMMVWFX-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |