C17H20N2O4 — CID 42223850
5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]furan-2-carboxylate (PubChem CID 42223850) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]furan-2-carboxylate.
| Compound Name | 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 42223850 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 5-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]furan-2-carboxylate |
| SMILES | COc1ccccc1N1CC[NH+](Cc2ccc(C(=O)[O-])o2)CC1 |
| InChI | InChI=1S/C17H20N2O4/c1-22-15-5-3-2-4-14(15)19-10-8-18(9-11-19)12-13-6-7-16(23-13)17(20)21/h2-7H,8-12H2,1H3,(H,20,21) |
| InChIKey | MRXPPHUZEZEHAG-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |