C22H32N3O+ — CID 7440843
N,N-diethyl-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]aniline (PubChem CID 7440843) has the molecular formula C22H32N3O+ and a molecular weight of 354.52 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 7440843 |
| Molecular Formula | C22H32N3O+ |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | N,N-diethyl-4-[[4-(2-methoxyphenyl)piperazin-1-ium-1-yl]methyl]aniline |
| SMILES | CCN(CC)c1ccc(C[NH+]2CCN(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O/c1-4-24(5-2)20-12-10-19(11-13-20)18-23-14-16-25(17-15-23)21-8-6-7-9-22(21)26-3/h6-13H,4-5,14-18H2,1-3H3/p+1 |
| InChIKey | ICBYBOAKIFQBAU-UHFFFAOYSA-O |
| XLogP | 2.45 |
| TPSA | 20.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|