C21H29N2O3+ — CID 6975358
1-[(3,5-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazin-1-ium (PubChem CID 6975358) has the molecular formula C21H29N2O3+ and a molecular weight of 357.47 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6975358 |
| Molecular Formula | C21H29N2O3+ |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-ethoxyphenyl)piperazin-1-ium |
| SMILES | CCOc1ccccc1N1CC[NH+](Cc2cc(OC)cc(OC)c2)CC1 |
| InChI | InChI=1S/C21H28N2O3/c1-4-26-21-8-6-5-7-20(21)23-11-9-22(10-12-23)16-17-13-18(24-2)15-19(14-17)25-3/h5-8,13-15H,4,9-12,16H2,1-3H3/p+1 |
| InChIKey | YLMLSFUXNQXJAH-UHFFFAOYSA-O |
| XLogP | 2.01 |
| TPSA | 35.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |