C21H29N2O2+ — CID 6940677
1-[(3,5-dimethoxyphenyl)methyl]-4-(2,3-dimethylphenyl)piperazin-1-ium (PubChem CID 6940677) has the molecular formula C21H29N2O2+ and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-4-(2,3-dimethylphenyl)piperazin-1-ium.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2,3-dimethylphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6940677 |
| Molecular Formula | C21H29N2O2+ |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2,3-dimethylphenyl)piperazin-1-ium |
| SMILES | COc1cc(C[NH+]2CCN(c3cccc(C)c3C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C21H28N2O2/c1-16-6-5-7-21(17(16)2)23-10-8-22(9-11-23)15-18-12-19(24-3)14-20(13-18)25-4/h5-7,12-14H,8-11,15H2,1-4H3/p+1 |
| InChIKey | DTWXETFCQUNYGT-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |