C20H27N2O2+ — CID 6938160
1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylphenyl)piperazin-1-ium (PubChem CID 6938160) has the molecular formula C20H27N2O2+ and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylphenyl)piperazin-1-ium.
| Compound Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 6938160 |
| Molecular Formula | C20H27N2O2+ |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-[(3,5-dimethoxyphenyl)methyl]-4-(2-methylphenyl)piperazin-1-ium |
| SMILES | COc1cc(C[NH+]2CCN(c3ccccc3C)CC2)cc(OC)c1 |
| InChI | InChI=1S/C20H26N2O2/c1-16-6-4-5-7-20(16)22-10-8-21(9-11-22)15-17-12-18(23-2)14-19(13-17)24-3/h4-7,12-14H,8-11,15H2,1-3H3/p+1 |
| InChIKey | PUMQJOHJSDUXQC-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 26.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |