C16H21N2S+ — CID 6983170
1-(2-methylphenyl)-4-(thiophen-2-ylmethyl)piperazin-4-ium (PubChem CID 6983170) has the molecular formula C16H21N2S+ and a molecular weight of 273.43 g/mol. Its IUPAC name is 1-(2-methylphenyl)-4-(thiophen-2-ylmethyl)piperazin-4-ium.
| Compound Name | 1-(2-methylphenyl)-4-(thiophen-2-ylmethyl)piperazin-4-ium |
|---|---|
| PubChem CID | 6983170 |
| Molecular Formula | C16H21N2S+ |
| Molecular Weight | 273.43 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(2-methylphenyl)-4-(thiophen-2-ylmethyl)piperazin-4-ium |
| SMILES | Cc1ccccc1N1CC[NH+](Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H20N2S/c1-14-5-2-3-7-16(14)18-10-8-17(9-11-18)13-15-6-4-12-19-15/h2-7,12H,8-11,13H2,1H3/p+1 |
| InChIKey | HGUREMIREJWVIY-UHFFFAOYSA-O |
| XLogP | 1.96 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |