C11H16ClN2OS+ — CID 7131789
2-chloro-1-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]ethanone (PubChem CID 7131789) has the molecular formula C11H16ClN2OS+ and a molecular weight of 259.78 g/mol. Its IUPAC name is 2-chloro-1-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 7131789 |
| Molecular Formula | C11H16ClN2OS+ |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-chloro-1-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]ethanone |
| SMILES | O=C(CCl)N1CC[NH+](Cc2cccs2)CC1 |
| InChI | InChI=1S/C11H15ClN2OS/c12-8-11(15)14-5-3-13(4-6-14)9-10-2-1-7-16-10/h1-2,7H,3-6,8-9H2/p+1 |
| InChIKey | CNYRPLHEARDSQA-UHFFFAOYSA-O |
| XLogP | 0.21 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|