C20H23N4O2S+ — CID 135718354
2-[3-oxo-3-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]propyl]-3H-quinazolin-4-one (PubChem CID 135718354) has the molecular formula C20H23N4O2S+ and a molecular weight of 383.50 g/mol. Its IUPAC name is 2-[3-oxo-3-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]propyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-oxo-3-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]propyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135718354 |
| Molecular Formula | C20H23N4O2S+ |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[3-oxo-3-[4-(thiophen-2-ylmethyl)piperazin-4-ium-1-yl]propyl]-3H-quinazolin-4-one |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CC[NH+](Cc2cccs2)CC1 |
| InChI | InChI=1S/C20H22N4O2S/c25-19(24-11-9-23(10-12-24)14-15-4-3-13-27-15)8-7-18-21-17-6-2-1-5-16(17)20(26)22-18/h1-6,13H,7-12,14H2,(H,21,22,26)/p+1 |
| InChIKey | WBJOGGKJLPSTPA-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |