C18H19N4O3+ — CID 135777794
2-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135777794) has the molecular formula C18H19N4O3+ and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135777794 |
| Molecular Formula | C18H19N4O3+ |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-[[4-(furan-2-carbonyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=C(c1ccco1)N1CC[NH+](Cc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C18H18N4O3/c23-17-13-4-1-2-5-14(13)19-16(20-17)12-21-7-9-22(10-8-21)18(24)15-6-3-11-25-15/h1-6,11H,7-10,12H2,(H,19,20,23)/p+1 |
| InChIKey | PSPHDQZOAXBEFE-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |