C19H21N4O2+ — CID 135612921
2-[[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one (PubChem CID 135612921) has the molecular formula C19H21N4O2+ and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-[[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135612921 |
| Molecular Formula | C19H21N4O2+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[[4-(4-hydroxyphenyl)piperazin-1-ium-1-yl]methyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C[NH+]2CCN(c3ccc(O)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C19H20N4O2/c24-15-7-5-14(6-8-15)23-11-9-22(10-12-23)13-18-20-17-4-2-1-3-16(17)19(25)21-18/h1-8,24H,9-13H2,(H,20,21,25)/p+1 |
| InChIKey | WMWCGLFEWLOHOO-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |