C17H22N3O3+ — CID 135612943
ethyl 1-[(4-oxo-3H-quinazolin-2-yl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 135612943) has the molecular formula C17H22N3O3+ and a molecular weight of 316.38 g/mol. Its IUPAC name is ethyl 1-[(4-oxo-3H-quinazolin-2-yl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(4-oxo-3H-quinazolin-2-yl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 135612943 |
| Molecular Formula | C17H22N3O3+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | ethyl 1-[(4-oxo-3H-quinazolin-2-yl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2nc3ccccc3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C17H21N3O3/c1-2-23-17(22)12-7-9-20(10-8-12)11-15-18-14-6-4-3-5-13(14)16(21)19-15/h3-6,12H,2,7-11H2,1H3,(H,18,19,21)/p+1 |
| InChIKey | NQAWOGJYPQZFRA-UHFFFAOYSA-O |
| XLogP | 0.28 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |