C15H22NO3+ — CID 7047536
ethyl 1-[(4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxylate (PubChem CID 7047536) has the molecular formula C15H22NO3+ and a molecular weight of 264.34 g/mol. Its IUPAC name is ethyl 1-[(4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7047536 |
| Molecular Formula | C15H22NO3+ |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | ethyl 1-[(4-hydroxyphenyl)methyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](Cc2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C15H21NO3/c1-2-19-15(18)13-7-9-16(10-8-13)11-12-3-5-14(17)6-4-12/h3-6,13,17H,2,7-11H2,1H3/p+1 |
| InChIKey | TXJLQOPKXYTPLJ-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |