C17H26NO2+ — CID 6962639
ethyl 1-[(2S)-2-phenylpropyl]piperidin-1-ium-4-carboxylate (PubChem CID 6962639) has the molecular formula C17H26NO2+ and a molecular weight of 276.40 g/mol. Its IUPAC name is ethyl 1-[(2S)-2-phenylpropyl]piperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 1-[(2S)-2-phenylpropyl]piperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 6962639 |
| Molecular Formula | C17H26NO2+ |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | ethyl 1-[(2S)-2-phenylpropyl]piperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1CC[NH+](C[C@@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H25NO2/c1-3-20-17(19)16-9-11-18(12-10-16)13-14(2)15-7-5-4-6-8-15/h4-8,14,16H,3,9-13H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | WTKZLMHFHCIAGK-CQSZACIVSA-O |
| XLogP | 1.65 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |