C22H35N2O+ — CID 7299939
N-cycloheptyl-1-[(2R)-2-phenylpropyl]piperidin-1-ium-4-carboxamide (PubChem CID 7299939) has the molecular formula C22H35N2O+ and a molecular weight of 343.54 g/mol. Its IUPAC name is N-cycloheptyl-1-[(2R)-2-phenylpropyl]piperidin-1-ium-4-carboxamide.
| Compound Name | N-cycloheptyl-1-[(2R)-2-phenylpropyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7299939 |
| Molecular Formula | C22H35N2O+ |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | N-cycloheptyl-1-[(2R)-2-phenylpropyl]piperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H](C[NH+]1CCC(C(=O)NC2CCCCCC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H34N2O/c1-18(19-9-5-4-6-10-19)17-24-15-13-20(14-16-24)22(25)23-21-11-7-2-3-8-12-21/h4-6,9-10,18,20-21H,2-3,7-8,11-17H2,1H3,(H,23,25)/p+1/t18-/m0/s1 |
| InChIKey | DMLPBHVBMDDOKI-SFHVURJKSA-O |
| XLogP | 2.92 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |