C13H19N3 — CID 95766819
1-cyclopropyl-2-[(2S)-2-phenylpropyl]guanidine (PubChem CID 95766819) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(2S)-2-phenylpropyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[(2S)-2-phenylpropyl]guanidine |
|---|---|
| PubChem CID | 95766819 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-cyclopropyl-2-[(2S)-2-phenylpropyl]guanidine |
| SMILES | C[C@H](C/N=C(\N)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C13H19N3/c1-10(11-5-3-2-4-6-11)9-15-13(14)16-12-7-8-12/h2-6,10,12H,7-9H2,1H3,(H3,14,15,16)/t10-/m1/s1 |
| InChIKey | UPFYQVHIPORJKF-SNVBAGLBSA-N |
| XLogP | 1.86 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|