C19H23N3 — CID 166183703
1-cyclopropyl-2-(2,3-diphenylpropyl)guanidine (PubChem CID 166183703) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,3-diphenylpropyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(2,3-diphenylpropyl)guanidine |
|---|---|
| PubChem CID | 166183703 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-cyclopropyl-2-(2,3-diphenylpropyl)guanidine |
| SMILES | N/C(=N\CC(Cc1ccccc1)c1ccccc1)NC1CC1 |
| InChI | InChI=1S/C19H23N3/c20-19(22-18-11-12-18)21-14-17(16-9-5-2-6-10-16)13-15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H3,20,21,22) |
| InChIKey | DVTIMCSYXVTFQR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|