C20H27N3 — CID 111799912
1-tert-butyl-2-(2,3-diphenylpropyl)guanidine (PubChem CID 111799912) has the molecular formula C20H27N3 and a molecular weight of 309.46 g/mol. Its IUPAC name is 1-tert-butyl-2-(2,3-diphenylpropyl)guanidine.
| Compound Name | 1-tert-butyl-2-(2,3-diphenylpropyl)guanidine |
|---|---|
| PubChem CID | 111799912 |
| Molecular Formula | C20H27N3 |
| Molecular Weight | 309.46 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-tert-butyl-2-(2,3-diphenylpropyl)guanidine |
| SMILES | CC(C)(C)N/C(N)=N/CC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N3/c1-20(2,3)23-19(21)22-15-18(17-12-8-5-9-13-17)14-16-10-6-4-7-11-16/h4-13,18H,14-15H2,1-3H3,(H3,21,22,23) |
| InChIKey | WFGZVQZYCQWPPN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|