About hydrogen peroxide;1-phenylbutan-2-ylbenzene
hydrogen peroxide;1-phenylbutan-2-ylbenzene (PubChem CID 19777291) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is hydrogen peroxide;1-phenylbutan-2-ylbenzene.
Molecular Properties
| Compound Name | hydrogen peroxide;1-phenylbutan-2-ylbenzene |
| PubChem CID | 19777291 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | hydrogen peroxide;1-phenylbutan-2-ylbenzene |
| SMILES | CCC(Cc1ccccc1)c1ccccc1.OO |
| InChI | InChI=1S/C16H18.H2O2/c1-2-15(16-11-7-4-8-12-16)13-14-9-5-3-6-10-14;1-2/h3-12,15H,2,13H2,1H3;1-2H |
| InChIKey | KINLCXPYQDYVNG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze hydrogen peroxide;1-phenylbutan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen peroxide;1-phenylbutan-2-ylbenzene?
The IUPAC name of hydrogen peroxide;1-phenylbutan-2-ylbenzene (CID 19777291) is hydrogen peroxide;1-phenylbutan-2-ylbenzene.
What is the SMILES notation for hydrogen peroxide;1-phenylbutan-2-ylbenzene?
The canonical SMILES for hydrogen peroxide;1-phenylbutan-2-ylbenzene is CCC(Cc1ccccc1)c1ccccc1.OO.
What is the InChIKey of hydrogen peroxide;1-phenylbutan-2-ylbenzene?
The InChIKey is KINLCXPYQDYVNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.H2O2/c1-2-15(16-11-7-4-8-12-16)13-14-9-5-3-6-10-14;1-2/h3-12,15H,2,13H2,1H3;1-2H.
What are the key properties of hydrogen peroxide;1-phenylbutan-2-ylbenzene?
hydrogen peroxide;1-phenylbutan-2-ylbenzene has a molecular weight of 244.33 g/mol, XLogP of 4.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen peroxide;1-phenylbutan-2-ylbenzene is sourced from PubChem (CID 19777291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).