C19H23NO2 — CID 122037987
(2R)-3-phenyl-2-(2-phenylbutylamino)propanoic acid (PubChem CID 122037987) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (2R)-3-phenyl-2-(2-phenylbutylamino)propanoic acid.
| Compound Name | (2R)-3-phenyl-2-(2-phenylbutylamino)propanoic acid |
|---|---|
| PubChem CID | 122037987 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (2R)-3-phenyl-2-(2-phenylbutylamino)propanoic acid |
| SMILES | CCC(CN[C@H](Cc1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-2-16(17-11-7-4-8-12-17)14-20-18(19(21)22)13-15-9-5-3-6-10-15/h3-12,16,18,20H,2,13-14H2,1H3,(H,21,22)/t16?,18-/m1/s1 |
| InChIKey | OIGCBQBBBDZKGZ-UHUGOGIASA-N |
| XLogP | 3.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |