C16H17NO2 — CID 11832004
(2S)-2-(benzylamino)-3-phenylpropanoic acid (PubChem CID 11832004) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (2S)-2-(benzylamino)-3-phenylpropanoic acid.
| Compound Name | (2S)-2-(benzylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 11832004 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (2S)-2-(benzylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C16H17NO2/c18-16(19)15(11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2,(H,18,19)/t15-/m0/s1 |
| InChIKey | PIVJVCRQCUYKNZ-HNNXBMFYSA-N |
| XLogP | 2.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |