C26H23NO2 — CID 67590007
(2S)-2-(benzylamino)-3-(4-naphthalen-1-ylphenyl)propanoic acid (PubChem CID 67590007) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is (2S)-2-(benzylamino)-3-(4-naphthalen-1-ylphenyl)propanoic acid.
| Compound Name | (2S)-2-(benzylamino)-3-(4-naphthalen-1-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 67590007 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | (2S)-2-(benzylamino)-3-(4-naphthalen-1-ylphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(-c2cccc3ccccc23)cc1)NCc1ccccc1 |
| InChI | InChI=1S/C26H23NO2/c28-26(29)25(27-18-20-7-2-1-3-8-20)17-19-13-15-22(16-14-19)24-12-6-10-21-9-4-5-11-23(21)24/h1-16,25,27H,17-18H2,(H,28,29)/t25-/m0/s1 |
| InChIKey | CYQBKBNTHLRRAL-VWLOTQADSA-N |
| XLogP | 5.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |