C24H21NO2 — CID 18728959
(2S)-3-naphthalen-1-yl-2-(naphthalen-1-ylmethylamino)propanoic acid (PubChem CID 18728959) has the molecular formula C24H21NO2 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-3-naphthalen-1-yl-2-(naphthalen-1-ylmethylamino)propanoic acid.
| Compound Name | (2S)-3-naphthalen-1-yl-2-(naphthalen-1-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 18728959 |
| Molecular Formula | C24H21NO2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (2S)-3-naphthalen-1-yl-2-(naphthalen-1-ylmethylamino)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1cccc2ccccc12)NCc1cccc2ccccc12 |
| InChI | InChI=1S/C24H21NO2/c26-24(27)23(15-19-11-5-9-17-7-1-3-13-21(17)19)25-16-20-12-6-10-18-8-2-4-14-22(18)20/h1-14,23,25H,15-16H2,(H,26,27)/t23-/m0/s1 |
| InChIKey | QKGBZYHNVFCBJU-QHCPKHFHSA-N |
| XLogP | 4.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |