C14H14O3 — CID 10466391
(2R)-2-(hydroxymethyl)-3-naphthalen-1-ylpropanoic acid (PubChem CID 10466391) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2R)-2-(hydroxymethyl)-3-naphthalen-1-ylpropanoic acid.
| Compound Name | (2R)-2-(hydroxymethyl)-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 10466391 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (2R)-2-(hydroxymethyl)-3-naphthalen-1-ylpropanoic acid |
| SMILES | O=C(O)[C@@H](CO)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H14O3/c15-9-12(14(16)17)8-11-6-3-5-10-4-1-2-7-13(10)11/h1-7,12,15H,8-9H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | ALLLEAJULDEPSS-GFCCVEGCSA-N |
| XLogP | 2.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |