C16H15NO2 — CID 18611834
(2R)-4-cyano-2-(naphthalen-1-ylmethyl)butanoic acid (PubChem CID 18611834) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (2R)-4-cyano-2-(naphthalen-1-ylmethyl)butanoic acid.
| Compound Name | (2R)-4-cyano-2-(naphthalen-1-ylmethyl)butanoic acid |
|---|---|
| PubChem CID | 18611834 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (2R)-4-cyano-2-(naphthalen-1-ylmethyl)butanoic acid |
| SMILES | N#CCC[C@H](Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H15NO2/c17-10-4-8-14(16(18)19)11-13-7-3-6-12-5-1-2-9-15(12)13/h1-3,5-7,9,14H,4,8,11H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | IUUCKQWNDCPGRH-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |