C28H27NO3 — CID 67597873
2-[methyl-[3-naphthalen-1-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]propanoic acid (PubChem CID 67597873) has the molecular formula C28H27NO3 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[methyl-[3-naphthalen-1-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]propanoic acid.
| Compound Name | 2-[methyl-[3-naphthalen-1-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67597873 |
| Molecular Formula | C28H27NO3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 2-[methyl-[3-naphthalen-1-yl-2-(naphthalen-1-ylmethyl)propanoyl]amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)C(=O)C(Cc1cccc2ccccc12)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C28H27NO3/c1-19(28(31)32)29(2)27(30)24(17-22-13-7-11-20-9-3-5-15-25(20)22)18-23-14-8-12-21-10-4-6-16-26(21)23/h3-16,19,24H,17-18H2,1-2H3,(H,31,32) |
| InChIKey | GAYOJQJCVQTSGF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |