C17H22ClNO2 — CID 119913312
2-[methyl(3-naphthalen-1-ylpropyl)amino]propanoic acid;hydrochloride (PubChem CID 119913312) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-[methyl(3-naphthalen-1-ylpropyl)amino]propanoic acid;hydrochloride.
| Compound Name | 2-[methyl(3-naphthalen-1-ylpropyl)amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119913312 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-[methyl(3-naphthalen-1-ylpropyl)amino]propanoic acid;hydrochloride |
| SMILES | CC(C(=O)O)N(C)CCCc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C17H21NO2.ClH/c1-13(17(19)20)18(2)12-6-10-15-9-5-8-14-7-3-4-11-16(14)15;/h3-5,7-9,11,13H,6,10,12H2,1-2H3,(H,19,20);1H |
| InChIKey | OTMVQJCJMLYJLH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |