C17H19NO3 — CID 122099616
2-methyl-3-[methyl(2-naphthalen-1-ylethyl)amino]-3-oxopropanoic acid (PubChem CID 122099616) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 2-methyl-3-[methyl(2-naphthalen-1-ylethyl)amino]-3-oxopropanoic acid.
| Compound Name | 2-methyl-3-[methyl(2-naphthalen-1-ylethyl)amino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 122099616 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-methyl-3-[methyl(2-naphthalen-1-ylethyl)amino]-3-oxopropanoic acid |
| SMILES | CC(C(=O)O)C(=O)N(C)CCc1cccc2ccccc12 |
| InChI | InChI=1S/C17H19NO3/c1-12(17(20)21)16(19)18(2)11-10-14-8-5-7-13-6-3-4-9-15(13)14/h3-9,12H,10-11H2,1-2H3,(H,20,21) |
| InChIKey | CJQKNIXTAMQGDP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|