C16H18F2N2O — CID 71925562
3-(2,2-difluoroethyl)-1-methyl-1-(2-naphthalen-1-ylethyl)urea (PubChem CID 71925562) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1-methyl-1-(2-naphthalen-1-ylethyl)urea.
| Compound Name | 3-(2,2-difluoroethyl)-1-methyl-1-(2-naphthalen-1-ylethyl)urea |
|---|---|
| PubChem CID | 71925562 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-(2,2-difluoroethyl)-1-methyl-1-(2-naphthalen-1-ylethyl)urea |
| SMILES | CN(CCc1cccc2ccccc12)C(=O)NCC(F)F |
| InChI | InChI=1S/C16H18F2N2O/c1-20(16(21)19-11-15(17)18)10-9-13-7-4-6-12-5-2-3-8-14(12)13/h2-8,15H,9-11H2,1H3,(H,19,21) |
| InChIKey | AUJGHVHORGHXOO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |